C19H23ClFN3O3 — CID 71273621
tert-butyl (9aR)-3-(2-chloro-3-cyano-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 71273621) has the molecular formula C19H23ClFN3O3 and a molecular weight of 395.86 g/mol. Its IUPAC name is tert-butyl (9aR)-3-(2-chloro-3-cyano-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | tert-butyl (9aR)-3-(2-chloro-3-cyano-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 71273621 |
| Molecular Formula | C19H23ClFN3O3 |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | tert-butyl (9aR)-3-(2-chloro-3-cyano-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2CC(c3ccc(F)c(C#N)c3Cl)OC[C@H]2C1 |
| InChI | InChI=1S/C19H23ClFN3O3/c1-19(2,3)27-18(25)24-7-6-23-10-16(26-11-12(23)9-24)13-4-5-15(21)14(8-22)17(13)20/h4-5,12,16H,6-7,9-11H2,1-3H3/t12-,16?/m1/s1 |
| InChIKey | ZUWVOYWOLAJIPK-ZGTOLYCTSA-N |
| XLogP | 3.34 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |