C20H25F2N3O3 — CID 144537886
tert-butyl 3-(3-cyano-2,4-difluorophenyl)-1,3,4,6,7,8,10,10a-octahydro-[1,4]oxazino[4,3-a][1,4]diazepine-9-carboxylate (PubChem CID 144537886) has the molecular formula C20H25F2N3O3 and a molecular weight of 393.43 g/mol. Its IUPAC name is tert-butyl 3-(3-cyano-2,4-difluorophenyl)-1,3,4,6,7,8,10,10a-octahydro-[1,4]oxazino[4,3-a][1,4]diazepine-9-carboxylate.
| Compound Name | tert-butyl 3-(3-cyano-2,4-difluorophenyl)-1,3,4,6,7,8,10,10a-octahydro-[1,4]oxazino[4,3-a][1,4]diazepine-9-carboxylate |
|---|---|
| PubChem CID | 144537886 |
| Molecular Formula | C20H25F2N3O3 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | tert-butyl 3-(3-cyano-2,4-difluorophenyl)-1,3,4,6,7,8,10,10a-octahydro-[1,4]oxazino[4,3-a][1,4]diazepine-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN2CC(c3ccc(F)c(C#N)c3F)OCC2C1 |
| InChI | InChI=1S/C20H25F2N3O3/c1-20(2,3)28-19(26)25-8-4-7-24-11-17(27-12-13(24)10-25)14-5-6-16(21)15(9-23)18(14)22/h5-6,13,17H,4,7-8,10-12H2,1-3H3 |
| InChIKey | BYYRQQQJARAWRH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |