C19H23F2N3O3 — CID 123385846
tert-butyl (3S,9aS)-3-(3,5-difluoro-4-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 123385846) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is tert-butyl (3S,9aS)-3-(3,5-difluoro-4-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | tert-butyl (3S,9aS)-3-(3,5-difluoro-4-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 123385846 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | tert-butyl (3S,9aS)-3-(3,5-difluoro-4-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | [C-]#[N+]c1c(F)cc([C@H]2CN3CCN(C(=O)OC(C)(C)C)C[C@H]3CO2)cc1F |
| InChI | InChI=1S/C19H23F2N3O3/c1-19(2,3)27-18(25)24-6-5-23-10-16(26-11-13(23)9-24)12-7-14(20)17(22-4)15(21)8-12/h7-8,13,16H,5-6,9-11H2,1-3H3/t13-,16+/m0/s1 |
| InChIKey | COSKXZHWULZNLA-XJKSGUPXSA-N |
| XLogP | 3.51 |
| TPSA | 46.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|