C21H28FN3O3 — CID 123560822
tert-butyl (3S,9aR)-3-(4-fluoro-3-isocyano-2,5-dimethylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 123560822) has the molecular formula C21H28FN3O3 and a molecular weight of 389.47 g/mol. Its IUPAC name is tert-butyl (3S,9aR)-3-(4-fluoro-3-isocyano-2,5-dimethylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | tert-butyl (3S,9aR)-3-(4-fluoro-3-isocyano-2,5-dimethylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 123560822 |
| Molecular Formula | C21H28FN3O3 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | tert-butyl (3S,9aR)-3-(4-fluoro-3-isocyano-2,5-dimethylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | [C-]#[N+]c1c(C)c([C@H]2CN3CCN(C(=O)OC(C)(C)C)C[C@@H]3CO2)cc(C)c1F |
| InChI | InChI=1S/C21H28FN3O3/c1-13-9-16(14(2)19(23-6)18(13)22)17-11-24-7-8-25(10-15(24)12-27-17)20(26)28-21(3,4)5/h9,15,17H,7-8,10-12H2,1-5H3/t15-,17-/m1/s1 |
| InChIKey | KMAQDTBENFIGHF-NVXWUHKLSA-N |
| XLogP | 3.99 |
| TPSA | 46.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|