C22H28FN3O3 — CID 123639317
tert-butyl (3R,9aS)-3-(2-cyclopropyl-4-fluoro-3-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 123639317) has the molecular formula C22H28FN3O3 and a molecular weight of 401.48 g/mol. Its IUPAC name is tert-butyl (3R,9aS)-3-(2-cyclopropyl-4-fluoro-3-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | tert-butyl (3R,9aS)-3-(2-cyclopropyl-4-fluoro-3-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 123639317 |
| Molecular Formula | C22H28FN3O3 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | tert-butyl (3R,9aS)-3-(2-cyclopropyl-4-fluoro-3-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | [C-]#[N+]c1c(F)ccc([C@@H]2CN3CCN(C(=O)OC(C)(C)C)C[C@H]3CO2)c1C1CC1 |
| InChI | InChI=1S/C22H28FN3O3/c1-22(2,3)29-21(27)26-10-9-25-12-18(28-13-15(25)11-26)16-7-8-17(23)20(24-4)19(16)14-5-6-14/h7-8,14-15,18H,5-6,9-13H2,1-3H3/t15-,18-/m0/s1 |
| InChIKey | QTGSTCQTVPNDMM-YJBOKZPZSA-N |
| XLogP | 4.25 |
| TPSA | 46.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|