C22H30BrClN2O3S — CID 167133000
tert-butyl (4aR)-8-bromo-7-chloro-9-[2-(trimethyl-λ4-sulfanyl)ethynyl]-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate (PubChem CID 167133000) has the molecular formula C22H30BrClN2O3S and a molecular weight of 517.92 g/mol. Its IUPAC name is tert-butyl (4aR)-8-bromo-7-chloro-9-[2-(trimethyl-λ4-sulfanyl)ethynyl]-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate.
| Compound Name | tert-butyl (4aR)-8-bromo-7-chloro-9-[2-(trimethyl-λ4-sulfanyl)ethynyl]-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate |
|---|---|
| PubChem CID | 167133000 |
| Molecular Formula | C22H30BrClN2O3S |
| Molecular Weight | 517.92 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | tert-butyl (4aR)-8-bromo-7-chloro-9-[2-(trimethyl-λ4-sulfanyl)ethynyl]-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2Cc3cc(C#CS(C)(C)C)c(Br)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C22H30BrClN2O3S/c1-22(2,3)29-21(27)26-9-8-25-12-16-11-15(7-10-30(4,5)6)18(23)19(24)20(16)28-14-17(25)13-26/h11,17H,8-9,12-14H2,1-6H3/t17-/m1/s1 |
| InChIKey | YKRGJDFDUURTCO-QGZVFWFLSA-N |
| XLogP | 4.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|