C18H24BrClN2O4 — CID 163208321
tert-butyl (3R,9aS)-3-(4-bromo-3-chlorophenyl)-3-hydroxy-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 163208321) has the molecular formula C18H24BrClN2O4 and a molecular weight of 447.76 g/mol. Its IUPAC name is tert-butyl (3R,9aS)-3-(4-bromo-3-chlorophenyl)-3-hydroxy-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | tert-butyl (3R,9aS)-3-(4-bromo-3-chlorophenyl)-3-hydroxy-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 163208321 |
| Molecular Formula | C18H24BrClN2O4 |
| Molecular Weight | 447.76 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | tert-butyl (3R,9aS)-3-(4-bromo-3-chlorophenyl)-3-hydroxy-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C[C@@](O)(c3ccc(Br)c(Cl)c3)OC[C@@H]2C1 |
| InChI | InChI=1S/C18H24BrClN2O4/c1-17(2,3)26-16(23)21-6-7-22-11-18(24,25-10-13(22)9-21)12-4-5-14(19)15(20)8-12/h4-5,8,13,24H,6-7,9-11H2,1-3H3/t13-,18-/m0/s1 |
| InChIKey | QCULWZKAIQXOSX-UGSOOPFHSA-N |
| XLogP | 3.20 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |