C21H20Cl2F2N2O4 — CID 155484613
[(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3-hydroxy-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-6-fluoro-3-methoxyphenyl)methanone (PubChem CID 155484613) has the molecular formula C21H20Cl2F2N2O4 and a molecular weight of 473.30 g/mol. Its IUPAC name is [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3-hydroxy-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-6-fluoro-3-methoxyphenyl)methanone.
| Compound Name | [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3-hydroxy-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-6-fluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 155484613 |
| Molecular Formula | C21H20Cl2F2N2O4 |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3-hydroxy-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-6-fluoro-3-methoxyphenyl)methanone |
| SMILES | COc1ccc(F)c(C(=O)N2CCN3C[C@@](O)(c4ccc(F)c(Cl)c4)OC[C@@H]3C2)c1Cl |
| InChI | InChI=1S/C21H20Cl2F2N2O4/c1-30-17-5-4-16(25)18(19(17)23)20(28)26-6-7-27-11-21(29,31-10-13(27)9-26)12-2-3-15(24)14(22)8-12/h2-5,8,13,29H,6-7,9-11H2,1H3/t13-,21-/m0/s1 |
| InChIKey | GXZZXVSATBQVEW-ZSEKCTLFSA-N |
| XLogP | 3.28 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |