C22H23Cl2FN2O2 — CID 138740331
(2-chloro-3-methoxyphenyl)-[7-(4-chlorophenyl)-7-fluoro-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]methanone (PubChem CID 138740331) has the molecular formula C22H23Cl2FN2O2 and a molecular weight of 437.34 g/mol. Its IUPAC name is (2-chloro-3-methoxyphenyl)-[7-(4-chlorophenyl)-7-fluoro-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]methanone.
| Compound Name | (2-chloro-3-methoxyphenyl)-[7-(4-chlorophenyl)-7-fluoro-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 138740331 |
| Molecular Formula | C22H23Cl2FN2O2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (2-chloro-3-methoxyphenyl)-[7-(4-chlorophenyl)-7-fluoro-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CCN3CC(F)(c4ccc(Cl)cc4)CCC3C2)c1Cl |
| InChI | InChI=1S/C22H23Cl2FN2O2/c1-29-19-4-2-3-18(20(19)24)21(28)26-11-12-27-14-22(25,10-9-17(27)13-26)15-5-7-16(23)8-6-15/h2-8,17H,9-14H2,1H3 |
| InChIKey | FCIQUJKSRCDFJZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |