C20H21Cl2N3O4 — CID 155484579
3-[(3R,9aS)-8-(2-chloro-3-methoxybenzoyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-5-chloro-1H-pyridin-2-one (PubChem CID 155484579) has the molecular formula C20H21Cl2N3O4 and a molecular weight of 438.31 g/mol. Its IUPAC name is 3-[(3R,9aS)-8-(2-chloro-3-methoxybenzoyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-5-chloro-1H-pyridin-2-one.
| Compound Name | 3-[(3R,9aS)-8-(2-chloro-3-methoxybenzoyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-5-chloro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 155484579 |
| Molecular Formula | C20H21Cl2N3O4 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 3-[(3R,9aS)-8-(2-chloro-3-methoxybenzoyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-5-chloro-1H-pyridin-2-one |
| SMILES | COc1cccc(C(=O)N2CCN3C[C@@H](c4cc(Cl)c[nH]c4=O)OC[C@@H]3C2)c1Cl |
| InChI | InChI=1S/C20H21Cl2N3O4/c1-28-16-4-2-3-14(18(16)22)20(27)25-6-5-24-10-17(29-11-13(24)9-25)15-7-12(21)8-23-19(15)26/h2-4,7-8,13,17H,5-6,9-11H2,1H3,(H,23,26)/t13-,17-/m0/s1 |
| InChIKey | ATINHCPZDISEDN-GUYCJALGSA-N |
| XLogP | 2.59 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |