C23H20Cl2F2N4O2 — CID 163208348
[(3S,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-chloro-3-(5-fluoro-1H-pyrazol-4-yl)phenyl]methanone (PubChem CID 163208348) has the molecular formula C23H20Cl2F2N4O2 and a molecular weight of 493.34 g/mol. Its IUPAC name is [(3S,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-chloro-3-(5-fluoro-1H-pyrazol-4-yl)phenyl]methanone.
| Compound Name | [(3S,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-chloro-3-(5-fluoro-1H-pyrazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 163208348 |
| Molecular Formula | C23H20Cl2F2N4O2 |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | [(3S,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-chloro-3-(5-fluoro-1H-pyrazol-4-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-c2cn[nH]c2F)c1Cl)N1CCN2C[C@H](c3ccc(F)c(Cl)c3)OC[C@@H]2C1 |
| InChI | InChI=1S/C23H20Cl2F2N4O2/c24-18-8-13(4-5-19(18)26)20-11-30-6-7-31(10-14(30)12-33-20)23(32)16-3-1-2-15(21(16)25)17-9-28-29-22(17)27/h1-5,8-9,14,20H,6-7,10-12H2,(H,28,29)/t14-,20+/m0/s1 |
| InChIKey | IOTRMYQYBCADAR-VBKZILBWSA-N |
| XLogP | 4.56 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |