C21H21Cl2FN2O3 — CID 155484750
[(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-3-methoxyphenyl)methanone (PubChem CID 155484750) has the molecular formula C21H21Cl2FN2O3 and a molecular weight of 439.31 g/mol. Its IUPAC name is [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-3-methoxyphenyl)methanone.
| Compound Name | [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 155484750 |
| Molecular Formula | C21H21Cl2FN2O3 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCN3C[C@@H](c4ccc(F)c(Cl)c4)OC[C@@H]3C2)c1Cl |
| InChI | InChI=1S/C21H21Cl2FN2O3/c1-28-18-4-2-3-15(20(18)23)21(27)26-8-7-25-11-19(29-12-14(25)10-26)13-5-6-17(24)16(22)9-13/h2-6,9,14,19H,7-8,10-12H2,1H3/t14-,19-/m0/s1 |
| InChIKey | ZXTRXHZSSOQTAT-LIRRHRJNSA-N |
| XLogP | 4.04 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |