C24H21Cl2F2N3O2 — CID 167543420
[(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-chloro-3-(5-fluoro-2H-pyrrol-4-yl)phenyl]methanone (PubChem CID 167543420) has the molecular formula C24H21Cl2F2N3O2 and a molecular weight of 492.35 g/mol. Its IUPAC name is [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-chloro-3-(5-fluoro-2H-pyrrol-4-yl)phenyl]methanone.
| Compound Name | [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-chloro-3-(5-fluoro-2H-pyrrol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 167543420 |
| Molecular Formula | C24H21Cl2F2N3O2 |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | [(3R,9aS)-3-(3-chloro-4-fluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-chloro-3-(5-fluoro-2H-pyrrol-4-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(C2=CCN=C2F)c1Cl)N1CCN2C[C@@H](c3ccc(F)c(Cl)c3)OC[C@@H]2C1 |
| InChI | InChI=1S/C24H21Cl2F2N3O2/c25-19-10-14(4-5-20(19)27)21-12-30-8-9-31(11-15(30)13-33-21)24(32)18-3-1-2-16(22(18)26)17-6-7-29-23(17)28/h1-6,10,15,21H,7-9,11-13H2/t15-,21-/m0/s1 |
| InChIKey | BMHOTKIPBQGRGO-BTYIYWSLSA-N |
| XLogP | 4.80 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |