C25H24ClF2N3O2 — CID 165028967
[(7S,9aR)-7-(3-chloro-4-fluorophenyl)-7-hydroxy-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-[2-fluoro-3-(2H-pyrrol-5-yl)phenyl]methanone (PubChem CID 165028967) has the molecular formula C25H24ClF2N3O2 and a molecular weight of 471.94 g/mol. Its IUPAC name is [(7S,9aR)-7-(3-chloro-4-fluorophenyl)-7-hydroxy-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-[2-fluoro-3-(2H-pyrrol-5-yl)phenyl]methanone.
| Compound Name | [(7S,9aR)-7-(3-chloro-4-fluorophenyl)-7-hydroxy-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-[2-fluoro-3-(2H-pyrrol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 165028967 |
| Molecular Formula | C25H24ClF2N3O2 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [(7S,9aR)-7-(3-chloro-4-fluorophenyl)-7-hydroxy-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-[2-fluoro-3-(2H-pyrrol-5-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(C2=NCC=C2)c1F)N1CCN2C[C@@](O)(c3ccc(F)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C25H24ClF2N3O2/c26-20-13-16(6-7-21(20)27)25(33)9-8-17-14-30(11-12-31(17)15-25)24(32)19-4-1-3-18(23(19)28)22-5-2-10-29-22/h1-7,13,17,33H,8-12,14-15H2/t17-,25-/m1/s1 |
| InChIKey | MILSZKJNVLNUCK-CRICUBBOSA-N |
| XLogP | 3.79 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |