C22H23ClF2N2O3 — CID 155457052
[(7R,9aS)-7-(3,4-difluorophenyl)-7-hydroxy-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methoxyphenyl)methanone (PubChem CID 155457052) has the molecular formula C22H23ClF2N2O3 and a molecular weight of 436.89 g/mol. Its IUPAC name is [(7R,9aS)-7-(3,4-difluorophenyl)-7-hydroxy-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methoxyphenyl)methanone.
| Compound Name | [(7R,9aS)-7-(3,4-difluorophenyl)-7-hydroxy-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 155457052 |
| Molecular Formula | C22H23ClF2N2O3 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [(7R,9aS)-7-(3,4-difluorophenyl)-7-hydroxy-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCN3C[C@](O)(c4ccc(F)c(F)c4)CC[C@H]3C2)c1Cl |
| InChI | InChI=1S/C22H23ClF2N2O3/c1-30-19-4-2-3-16(20(19)23)21(28)26-9-10-27-13-22(29,8-7-15(27)12-26)14-5-6-17(24)18(25)11-14/h2-6,11,15,29H,7-10,12-13H2,1H3/t15-,22-/m0/s1 |
| InChIKey | CAXGHTRYRWRCGN-NYHFZMIOSA-N |
| XLogP | 3.43 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |