C23H23Cl2F2NO3 — CID 139307067
[2-chloro-3-(difluoromethoxy)phenyl]-[(6R)-6-(4-chlorophenyl)-6-hydroxy-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]methanone (PubChem CID 139307067) has the molecular formula C23H23Cl2F2NO3 and a molecular weight of 470.34 g/mol. Its IUPAC name is [2-chloro-3-(difluoromethoxy)phenyl]-[(6R)-6-(4-chlorophenyl)-6-hydroxy-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]methanone.
| Compound Name | [2-chloro-3-(difluoromethoxy)phenyl]-[(6R)-6-(4-chlorophenyl)-6-hydroxy-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 139307067 |
| Molecular Formula | C23H23Cl2F2NO3 |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | [2-chloro-3-(difluoromethoxy)phenyl]-[(6R)-6-(4-chlorophenyl)-6-hydroxy-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]methanone |
| SMILES | O=C(c1cccc(OC(F)F)c1Cl)N1CCC2C[C@@](O)(c3ccc(Cl)cc3)CCC2C1 |
| InChI | InChI=1S/C23H23Cl2F2NO3/c24-17-6-4-16(5-7-17)23(30)10-8-15-13-28(11-9-14(15)12-23)21(29)18-2-1-3-19(20(18)25)31-22(26)27/h1-7,14-15,22,30H,8-13H2/t14?,15?,23-/m1/s1 |
| InChIKey | RUMNUGRPUKSVJD-CKBDLISKSA-N |
| XLogP | 5.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |