C22H22ClF3N2O4 — CID 155484699
[(3R,9aS)-3-hydroxy-3-[3-(trifluoromethyl)phenyl]-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-3-methoxyphenyl)methanone (PubChem CID 155484699) has the molecular formula C22H22ClF3N2O4 and a molecular weight of 470.88 g/mol. Its IUPAC name is [(3R,9aS)-3-hydroxy-3-[3-(trifluoromethyl)phenyl]-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-3-methoxyphenyl)methanone.
| Compound Name | [(3R,9aS)-3-hydroxy-3-[3-(trifluoromethyl)phenyl]-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 155484699 |
| Molecular Formula | C22H22ClF3N2O4 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | [(3R,9aS)-3-hydroxy-3-[3-(trifluoromethyl)phenyl]-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-8-yl]-(2-chloro-3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCN3C[C@@](O)(c4cccc(C(F)(F)F)c4)OC[C@@H]3C2)c1Cl |
| InChI | InChI=1S/C22H22ClF3N2O4/c1-31-18-7-3-6-17(19(18)23)20(29)27-8-9-28-13-21(30,32-12-16(28)11-27)14-4-2-5-15(10-14)22(24,25)26/h2-7,10,16,30H,8-9,11-13H2,1H3/t16-,21-/m0/s1 |
| InChIKey | MGPYWQDQNYXIJX-KKSFZXQISA-N |
| XLogP | 3.37 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |