C22H20Cl2FN3O3 — CID 155484679
5-[(3R,9aS)-8-(2-chloro-3-methoxybenzoyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-3-chloro-2-fluorobenzonitrile (PubChem CID 155484679) has the molecular formula C22H20Cl2FN3O3 and a molecular weight of 464.32 g/mol. Its IUPAC name is 5-[(3R,9aS)-8-(2-chloro-3-methoxybenzoyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-3-chloro-2-fluorobenzonitrile.
| Compound Name | 5-[(3R,9aS)-8-(2-chloro-3-methoxybenzoyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-3-chloro-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 155484679 |
| Molecular Formula | C22H20Cl2FN3O3 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 5-[(3R,9aS)-8-(2-chloro-3-methoxybenzoyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-3-chloro-2-fluorobenzonitrile |
| SMILES | COc1cccc(C(=O)N2CCN3C[C@@H](c4cc(Cl)c(F)c(C#N)c4)OC[C@@H]3C2)c1Cl |
| InChI | InChI=1S/C22H20Cl2FN3O3/c1-30-18-4-2-3-16(20(18)24)22(29)28-6-5-27-11-19(31-12-15(27)10-28)13-7-14(9-26)21(25)17(23)8-13/h2-4,7-8,15,19H,5-6,10-12H2,1H3/t15-,19-/m0/s1 |
| InChIKey | QAMNSXTWAISJSJ-KXBFYZLASA-N |
| XLogP | 3.91 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |