C21H19Cl2FN4OS — CID 138740241
[7-(3-chloro-4-fluorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chloro-[1,2]thiazolo[5,4-b]pyridin-5-yl)methanone (PubChem CID 138740241) has the molecular formula C21H19Cl2FN4OS and a molecular weight of 465.38 g/mol. Its IUPAC name is [7-(3-chloro-4-fluorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chloro-[1,2]thiazolo[5,4-b]pyridin-5-yl)methanone.
| Compound Name | [7-(3-chloro-4-fluorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chloro-[1,2]thiazolo[5,4-b]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 138740241 |
| Molecular Formula | C21H19Cl2FN4OS |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | [7-(3-chloro-4-fluorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chloro-[1,2]thiazolo[5,4-b]pyridin-5-yl)methanone |
| SMILES | O=C(c1cnc2sncc2c1Cl)N1CCN2CC(c3ccc(F)c(Cl)c3)CCC2C1 |
| InChI | InChI=1S/C21H19Cl2FN4OS/c22-17-7-12(2-4-18(17)24)13-1-3-14-11-28(6-5-27(14)10-13)21(29)16-8-25-20-15(19(16)23)9-26-30-20/h2,4,7-9,13-14H,1,3,5-6,10-11H2 |
| InChIKey | YSZMNALGHDXKRJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |