C26H28ClN3O2 — CID 157452836
[(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-chloro-3-(2H-pyrrol-4-ylmethoxy)phenyl]methanone (PubChem CID 157452836) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-chloro-3-(2H-pyrrol-4-ylmethoxy)phenyl]methanone.
| Compound Name | [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-chloro-3-(2H-pyrrol-4-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 157452836 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-chloro-3-(2H-pyrrol-4-ylmethoxy)phenyl]methanone |
| SMILES | O=C(c1cccc(OCC2=CCN=C2)c1Cl)N1CCN2C[C@@H](c3ccccc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C26H28ClN3O2/c27-25-23(7-4-8-24(25)32-18-19-11-12-28-15-19)26(31)30-14-13-29-16-21(9-10-22(29)17-30)20-5-2-1-3-6-20/h1-8,11,15,21-22H,9-10,12-14,16-18H2/t21-,22+/m0/s1 |
| InChIKey | BSZOSEPGOLYANY-FCHUYYIVSA-N |
| XLogP | 4.43 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |