C24H27ClN2O4 — CID 138740582
(2-chloro-3-methoxyphenyl)-[7-[(4-methoxyphenyl)methoxy]-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone (PubChem CID 138740582) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is (2-chloro-3-methoxyphenyl)-[7-[(4-methoxyphenyl)methoxy]-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone.
| Compound Name | (2-chloro-3-methoxyphenyl)-[7-[(4-methoxyphenyl)methoxy]-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 138740582 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (2-chloro-3-methoxyphenyl)-[7-[(4-methoxyphenyl)methoxy]-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone |
| SMILES | COc1ccc(COC2=CCC3CN(C(=O)c4cccc(OC)c4Cl)CCN3C2)cc1 |
| InChI | InChI=1S/C24H27ClN2O4/c1-29-19-9-6-17(7-10-19)16-31-20-11-8-18-14-27(13-12-26(18)15-20)24(28)21-4-3-5-22(30-2)23(21)25/h3-7,9-11,18H,8,12-16H2,1-2H3 |
| InChIKey | MESQQJLTYCODFI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |