C22H25ClN2O — CID 138740245
[(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methylphenyl)methanone (PubChem CID 138740245) has the molecular formula C22H25ClN2O and a molecular weight of 368.91 g/mol. Its IUPAC name is [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methylphenyl)methanone.
| Compound Name | [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 138740245 |
| Molecular Formula | C22H25ClN2O |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2-chloro-3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCN3C[C@@H](c4ccccc4)CC[C@@H]3C2)c1Cl |
| InChI | InChI=1S/C22H25ClN2O/c1-16-6-5-9-20(21(16)23)22(26)25-13-12-24-14-18(10-11-19(24)15-25)17-7-3-2-4-8-17/h2-9,18-19H,10-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | IQUYJJYIYNXAIF-RBUKOAKNSA-N |
| XLogP | 4.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |