C24H26ClN3OS — CID 138740602
[(7R,9aR)-7-(4-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2,4-dimethyl-1,3-benzothiazol-5-yl)methanone (PubChem CID 138740602) has the molecular formula C24H26ClN3OS and a molecular weight of 440.01 g/mol. Its IUPAC name is [(7R,9aR)-7-(4-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2,4-dimethyl-1,3-benzothiazol-5-yl)methanone.
| Compound Name | [(7R,9aR)-7-(4-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2,4-dimethyl-1,3-benzothiazol-5-yl)methanone |
|---|---|
| PubChem CID | 138740602 |
| Molecular Formula | C24H26ClN3OS |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [(7R,9aR)-7-(4-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2,4-dimethyl-1,3-benzothiazol-5-yl)methanone |
| SMILES | Cc1nc2c(C)c(C(=O)N3CCN4C[C@@H](c5ccc(Cl)cc5)CC[C@@H]4C3)ccc2s1 |
| InChI | InChI=1S/C24H26ClN3OS/c1-15-21(9-10-22-23(15)26-16(2)30-22)24(29)28-12-11-27-13-18(5-8-20(27)14-28)17-3-6-19(25)7-4-17/h3-4,6-7,9-10,18,20H,5,8,11-14H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | AUYANRWCLFNAIJ-AZUAARDMSA-N |
| XLogP | 5.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |