C21H20Cl2FN5O — CID 155769810
[(7R,9aR)-7-(3-chloro-4-fluorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(3-chloro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone (PubChem CID 155769810) has the molecular formula C21H20Cl2FN5O and a molecular weight of 448.33 g/mol. Its IUPAC name is [(7R,9aR)-7-(3-chloro-4-fluorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(3-chloro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone.
| Compound Name | [(7R,9aR)-7-(3-chloro-4-fluorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(3-chloro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 155769810 |
| Molecular Formula | C21H20Cl2FN5O |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [(7R,9aR)-7-(3-chloro-4-fluorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(3-chloro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone |
| SMILES | O=C(c1ccc2nnc(Cl)n2c1)N1CCN2C[C@@H](c3ccc(F)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C21H20Cl2FN5O/c22-17-9-13(2-5-18(17)24)14-1-4-16-12-28(8-7-27(16)10-14)20(30)15-3-6-19-25-26-21(23)29(19)11-15/h2-3,5-6,9,11,14,16H,1,4,7-8,10,12H2/t14-,16+/m0/s1 |
| InChIKey | BZYGVAOYYDGAMC-GOEBONIOSA-N |
| XLogP | 3.88 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |