C21H22ClFN2O2 — CID 68811316
[4-(3-chloro-4-fluorophenoxy)phenyl]-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone (PubChem CID 68811316) has the molecular formula C21H22ClFN2O2 and a molecular weight of 388.87 g/mol. Its IUPAC name is [4-(3-chloro-4-fluorophenoxy)phenyl]-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone.
| Compound Name | [4-(3-chloro-4-fluorophenoxy)phenyl]-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 68811316 |
| Molecular Formula | C21H22ClFN2O2 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [4-(3-chloro-4-fluorophenoxy)phenyl]-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Oc2ccc(F)c(Cl)c2)cc1)N1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C21H22ClFN2O2/c22-19-13-18(7-8-20(19)23)27-17-5-3-15(4-6-17)21(26)25-12-9-16(14-25)24-10-1-2-11-24/h3-8,13,16H,1-2,9-12,14H2 |
| InChIKey | CCZGBCCDZHTUEX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |