C27H27FN2O3 — CID 24794465
[4-[4-(4-fluorophenoxy)phenoxy]phenyl]-[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone (PubChem CID 24794465) has the molecular formula C27H27FN2O3 and a molecular weight of 446.52 g/mol. Its IUPAC name is [4-[4-(4-fluorophenoxy)phenoxy]phenyl]-[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone.
| Compound Name | [4-[4-(4-fluorophenoxy)phenoxy]phenyl]-[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 24794465 |
| Molecular Formula | C27H27FN2O3 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [4-[4-(4-fluorophenoxy)phenoxy]phenyl]-[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Oc2ccc(Oc3ccc(F)cc3)cc2)cc1)N1CC[C@H](N2CCCC2)C1 |
| InChI | InChI=1S/C27H27FN2O3/c28-21-5-9-24(10-6-21)33-26-13-11-25(12-14-26)32-23-7-3-20(4-8-23)27(31)30-18-15-22(19-30)29-16-1-2-17-29/h3-14,22H,1-2,15-19H2/t22-/m0/s1 |
| InChIKey | RTRPSRRXGSCHKD-QFIPXVFZSA-N |
| XLogP | 5.72 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |