C30H35ClN4O4 — CID 139307061
tert-butyl 4-[[3-[(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-2-chlorophenoxy]methyl]pyrazole-1-carboxylate (PubChem CID 139307061) has the molecular formula C30H35ClN4O4 and a molecular weight of 551.09 g/mol. Its IUPAC name is tert-butyl 4-[[3-[(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-2-chlorophenoxy]methyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-[(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-2-chlorophenoxy]methyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 139307061 |
| Molecular Formula | C30H35ClN4O4 |
| Molecular Weight | 551.09 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | tert-butyl 4-[[3-[(7R,9aR)-7-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-2-chlorophenoxy]methyl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(COc2cccc(C(=O)N3CCN4C[C@@H](c5ccccc5)CC[C@@H]4C3)c2Cl)cn1 |
| InChI | InChI=1S/C30H35ClN4O4/c1-30(2,3)39-29(37)35-17-21(16-32-35)20-38-26-11-7-10-25(27(26)31)28(36)34-15-14-33-18-23(12-13-24(33)19-34)22-8-5-4-6-9-22/h4-11,16-17,23-24H,12-15,18-20H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | RLIOYMCGCVPARH-BJKOFHAPSA-N |
| XLogP | 5.60 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.09 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |