C21H24BrCl2FN4O2 — CID 171422996
tert-butyl 9-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-1,9-diazaspiro[4.5]decane-1-carboxylate (PubChem CID 171422996) has the molecular formula C21H24BrCl2FN4O2 and a molecular weight of 534.26 g/mol. Its IUPAC name is tert-butyl 9-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-1,9-diazaspiro[4.5]decane-1-carboxylate.
| Compound Name | tert-butyl 9-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-1,9-diazaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 171422996 |
| Molecular Formula | C21H24BrCl2FN4O2 |
| Molecular Weight | 534.26 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | tert-butyl 9-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-1,9-diazaspiro[4.5]decane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CCCN(c1nc(Cl)nc3c(F)c(Br)c(Cl)cc13)C2 |
| InChI | InChI=1S/C21H24BrCl2FN4O2/c1-20(2,3)31-19(30)29-9-5-7-21(29)6-4-8-28(11-21)17-12-10-13(23)14(22)15(25)16(12)26-18(24)27-17/h10H,4-9,11H2,1-3H3 |
| InChIKey | QHGKDGRIKMCCBD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.26 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|