C22H21ClN6O — CID 123989627
(2R,5S)-4-(3-chloro-4-isocyanophenyl)-2,5-dimethyl-N-quinoxalin-2-ylpiperazine-1-carboxamide (PubChem CID 123989627) has the molecular formula C22H21ClN6O and a molecular weight of 420.90 g/mol. Its IUPAC name is (2R,5S)-4-(3-chloro-4-isocyanophenyl)-2,5-dimethyl-N-quinoxalin-2-ylpiperazine-1-carboxamide.
| Compound Name | (2R,5S)-4-(3-chloro-4-isocyanophenyl)-2,5-dimethyl-N-quinoxalin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 123989627 |
| Molecular Formula | C22H21ClN6O |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2R,5S)-4-(3-chloro-4-isocyanophenyl)-2,5-dimethyl-N-quinoxalin-2-ylpiperazine-1-carboxamide |
| SMILES | [C-]#[N+]c1ccc(N2C[C@@H](C)N(C(=O)Nc3cnc4ccccc4n3)C[C@@H]2C)cc1Cl |
| InChI | InChI=1S/C22H21ClN6O/c1-14-13-29(15(2)12-28(14)16-8-9-18(24-3)17(23)10-16)22(30)27-21-11-25-19-6-4-5-7-20(19)26-21/h4-11,14-15H,12-13H2,1-2H3,(H,26,27,30)/t14-,15+/m0/s1 |
| InChIKey | MLAYMAXIUBGMQU-LSDHHAIUSA-N |
| XLogP | 4.97 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|