C22H34N2O4 — CID 139945179
tert-butyl (2S,5R)-4-[4-(3-ethoxy-3-oxopropyl)phenyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 139945179) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is tert-butyl (2S,5R)-4-[4-(3-ethoxy-3-oxopropyl)phenyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-4-[4-(3-ethoxy-3-oxopropyl)phenyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 139945179 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | tert-butyl (2S,5R)-4-[4-(3-ethoxy-3-oxopropyl)phenyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)CCc1ccc(N2C[C@H](C)N(C(=O)OC(C)(C)C)C[C@H]2C)cc1 |
| InChI | InChI=1S/C22H34N2O4/c1-7-27-20(25)13-10-18-8-11-19(12-9-18)23-14-17(3)24(15-16(23)2)21(26)28-22(4,5)6/h8-9,11-12,16-17H,7,10,13-15H2,1-6H3/t16-,17+/m1/s1 |
| InChIKey | JGWGMIMUGJTKNK-SJORKVTESA-N |
| XLogP | 4.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|