C24H26ClN3O2 — CID 170513738
N-[(1S,3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylcyclobutyl]-2-methyl-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 170513738) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is N-[(1S,3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylcyclobutyl]-2-methyl-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | N-[(1S,3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylcyclobutyl]-2-methyl-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 170513738 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[(1S,3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylcyclobutyl]-2-methyl-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | [C-]#[N+]c1ccc(O[C@H]2C[C@H](NC(=O)c3ccc4c(c3)CCN(C)C4)C2(C)C)cc1Cl |
| InChI | InChI=1S/C24H26ClN3O2/c1-24(2)21(13-22(24)30-18-7-8-20(26-3)19(25)12-18)27-23(29)16-5-6-17-14-28(4)10-9-15(17)11-16/h5-8,11-12,21-22H,9-10,13-14H2,1-2,4H3,(H,27,29)/t21-,22-/m0/s1 |
| InChIKey | OQOREDCLNRIUNF-VXKWHMMOSA-N |
| XLogP | 4.85 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|