C21H21ClN2O2 — CID 170513891
[(3S,4R)-3-(3-chloro-4-isocyanophenoxy)-4-methylpiperidin-1-yl]-(4-methylphenyl)methanone (PubChem CID 170513891) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is [(3S,4R)-3-(3-chloro-4-isocyanophenoxy)-4-methylpiperidin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [(3S,4R)-3-(3-chloro-4-isocyanophenoxy)-4-methylpiperidin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 170513891 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [(3S,4R)-3-(3-chloro-4-isocyanophenoxy)-4-methylpiperidin-1-yl]-(4-methylphenyl)methanone |
| SMILES | [C-]#[N+]c1ccc(O[C@@H]2CN(C(=O)c3ccc(C)cc3)CC[C@H]2C)cc1Cl |
| InChI | InChI=1S/C21H21ClN2O2/c1-14-4-6-16(7-5-14)21(25)24-11-10-15(2)20(13-24)26-17-8-9-19(23-3)18(22)12-17/h4-9,12,15,20H,10-11,13H2,1-2H3/t15-,20-/m1/s1 |
| InChIKey | MTPOEKKSWCPEEH-FOIQADDNSA-N |
| XLogP | 5.13 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|