C18H15ClN4O2 — CID 167417704
[6-(3-chloro-4-isocyanophenoxy)-2-azaspiro[3.3]heptan-2-yl]-pyrimidin-5-ylmethanone (PubChem CID 167417704) has the molecular formula C18H15ClN4O2 and a molecular weight of 354.80 g/mol. Its IUPAC name is [6-(3-chloro-4-isocyanophenoxy)-2-azaspiro[3.3]heptan-2-yl]-pyrimidin-5-ylmethanone.
| Compound Name | [6-(3-chloro-4-isocyanophenoxy)-2-azaspiro[3.3]heptan-2-yl]-pyrimidin-5-ylmethanone |
|---|---|
| PubChem CID | 167417704 |
| Molecular Formula | C18H15ClN4O2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [6-(3-chloro-4-isocyanophenoxy)-2-azaspiro[3.3]heptan-2-yl]-pyrimidin-5-ylmethanone |
| SMILES | [C-]#[N+]c1ccc(OC2CC3(C2)CN(C(=O)c2cncnc2)C3)cc1Cl |
| InChI | InChI=1S/C18H15ClN4O2/c1-20-16-3-2-13(4-15(16)19)25-14-5-18(6-14)9-23(10-18)17(24)12-7-21-11-22-8-12/h2-4,7-8,11,14H,5-6,9-10H2 |
| InChIKey | UHPUUZXVGJGUSW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|