C13H13ClN2O — CID 167417942
6-(3-chloro-4-isocyanophenoxy)-2-azaspiro[3.3]heptane (PubChem CID 167417942) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is 6-(3-chloro-4-isocyanophenoxy)-2-azaspiro[3.3]heptane.
| Compound Name | 6-(3-chloro-4-isocyanophenoxy)-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 167417942 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 6-(3-chloro-4-isocyanophenoxy)-2-azaspiro[3.3]heptane |
| SMILES | [C-]#[N+]c1ccc(OC2CC3(CNC3)C2)cc1Cl |
| InChI | InChI=1S/C13H13ClN2O/c1-15-12-3-2-9(4-11(12)14)17-10-5-13(6-10)7-16-8-13/h2-4,10,16H,5-8H2 |
| InChIKey | BODOTADOYNPCPZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 25.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|