C23H21ClN2O2 — CID 167417698
2-[5-(3-chloro-4-isocyanophenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3H-isoindol-1-one (PubChem CID 167417698) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 2-[5-(3-chloro-4-isocyanophenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3H-isoindol-1-one.
| Compound Name | 2-[5-(3-chloro-4-isocyanophenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 167417698 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[5-(3-chloro-4-isocyanophenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3H-isoindol-1-one |
| SMILES | [C-]#[N+]c1ccc(OC2CC3CC(N4Cc5ccccc5C4=O)CC3C2)cc1Cl |
| InChI | InChI=1S/C23H21ClN2O2/c1-25-22-7-6-18(12-21(22)24)28-19-10-15-8-17(9-16(15)11-19)26-13-14-4-2-3-5-20(14)23(26)27/h2-7,12,15-17,19H,8-11,13H2 |
| InChIKey | VTIDGNZALDAJTO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|