C11H15N3O3S — CID 123879971
(3-aminopyrrolidin-1-yl)-(5-methylsulfonyl-2-pyridinyl)methanone (PubChem CID 123879971) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(5-methylsulfonyl-2-pyridinyl)methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-(5-methylsulfonyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 123879971 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(5-methylsulfonyl-2-pyridinyl)methanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCC(N)C2)nc1 |
| InChI | InChI=1S/C11H15N3O3S/c1-18(16,17)9-2-3-10(13-6-9)11(15)14-5-4-8(12)7-14/h2-3,6,8H,4-5,7,12H2,1H3 |
| InChIKey | HSPMPOJAWRIHOY-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |