C8H11N3OS — CID 170767103
(3-aminopyrrolidin-1-yl)-(1,2-thiazol-3-yl)methanone (PubChem CID 170767103) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(1,2-thiazol-3-yl)methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-(1,2-thiazol-3-yl)methanone |
|---|---|
| PubChem CID | 170767103 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(1,2-thiazol-3-yl)methanone |
| SMILES | NC1CCN(C(=O)c2ccsn2)C1 |
| InChI | InChI=1S/C8H11N3OS/c9-6-1-3-11(5-6)8(12)7-2-4-13-10-7/h2,4,6H,1,3,5,9H2 |
| InChIKey | XFZXQQQUHJWBOL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |