C19H21N3O3S — CID 67616611
5-methylsulfonyl-1-(5-piperidin-4-yloxy-2-pyridinyl)indole (PubChem CID 67616611) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 5-methylsulfonyl-1-(5-piperidin-4-yloxy-2-pyridinyl)indole.
| Compound Name | 5-methylsulfonyl-1-(5-piperidin-4-yloxy-2-pyridinyl)indole |
|---|---|
| PubChem CID | 67616611 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 5-methylsulfonyl-1-(5-piperidin-4-yloxy-2-pyridinyl)indole |
| SMILES | CS(=O)(=O)c1ccc2c(ccn2-c2ccc(OC3CCNCC3)cn2)c1 |
| InChI | InChI=1S/C19H21N3O3S/c1-26(23,24)17-3-4-18-14(12-17)8-11-22(18)19-5-2-16(13-21-19)25-15-6-9-20-10-7-15/h2-5,8,11-13,15,20H,6-7,9-10H2,1H3 |
| InChIKey | OSNZNBRDGVOZDN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |