C9H9ClIN3 — CID 19597426
4-chloro-5-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidine (PubChem CID 19597426) has the molecular formula C9H9ClIN3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 4-chloro-5-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-5-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 19597426 |
| Molecular Formula | C9H9ClIN3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 4-chloro-5-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidine |
| SMILES | CC(C)n1cc(I)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C9H9ClIN3/c1-5(2)14-3-6(11)7-8(10)12-4-13-9(7)14/h3-5H,1-2H3 |
| InChIKey | KJHYDYATVCGFKG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|