C24H34IN5O2 — CID 167220649
tert-butyl 2-amino-3-[(Z)-2-amino-2-[3,5-dimethyl-4-(4-methylpiperazin-1-yl)phenyl]ethenyl]-4-iodopyrrole-1-carboxylate (PubChem CID 167220649) has the molecular formula C24H34IN5O2 and a molecular weight of 551.47 g/mol. Its IUPAC name is tert-butyl 2-amino-3-[(Z)-2-amino-2-[3,5-dimethyl-4-(4-methylpiperazin-1-yl)phenyl]ethenyl]-4-iodopyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-amino-3-[(Z)-2-amino-2-[3,5-dimethyl-4-(4-methylpiperazin-1-yl)phenyl]ethenyl]-4-iodopyrrole-1-carboxylate |
|---|---|
| PubChem CID | 167220649 |
| Molecular Formula | C24H34IN5O2 |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | tert-butyl 2-amino-3-[(Z)-2-amino-2-[3,5-dimethyl-4-(4-methylpiperazin-1-yl)phenyl]ethenyl]-4-iodopyrrole-1-carboxylate |
| SMILES | Cc1cc(/C(N)=C/c2c(I)cn(C(=O)OC(C)(C)C)c2N)cc(C)c1N1CCN(C)CC1 |
| InChI | InChI=1S/C24H34IN5O2/c1-15-11-17(12-16(2)21(15)29-9-7-28(6)8-10-29)20(26)13-18-19(25)14-30(22(18)27)23(31)32-24(3,4)5/h11-14H,7-10,26-27H2,1-6H3/b20-13- |
| InChIKey | QNNOBEIUFIRZKD-MOSHPQCFSA-N |
| XLogP | 4.28 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|