C26H31N3O2 — CID 89494182
tert-butyl 5-ethenyl-3-[4-(4-methylpiperazin-1-yl)phenyl]indole-1-carboxylate (PubChem CID 89494182) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl 5-ethenyl-3-[4-(4-methylpiperazin-1-yl)phenyl]indole-1-carboxylate.
| Compound Name | tert-butyl 5-ethenyl-3-[4-(4-methylpiperazin-1-yl)phenyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 89494182 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | tert-butyl 5-ethenyl-3-[4-(4-methylpiperazin-1-yl)phenyl]indole-1-carboxylate |
| SMILES | C=Cc1ccc2c(c1)c(-c1ccc(N3CCN(C)CC3)cc1)cn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H31N3O2/c1-6-19-7-12-24-22(17-19)23(18-29(24)25(30)31-26(2,3)4)20-8-10-21(11-9-20)28-15-13-27(5)14-16-28/h6-12,17-18H,1,13-16H2,2-5H3 |
| InChIKey | WXHGCUNDPRDKAA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |