C21H31N3O5 — CID 59531587
ditert-butyl 5-(4-formylphenyl)-1,2,5-triazepane-1,2-dicarboxylate (PubChem CID 59531587) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is ditert-butyl 5-(4-formylphenyl)-1,2,5-triazepane-1,2-dicarboxylate.
| Compound Name | ditert-butyl 5-(4-formylphenyl)-1,2,5-triazepane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59531587 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | ditert-butyl 5-(4-formylphenyl)-1,2,5-triazepane-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=O)cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N3O5/c1-20(2,3)28-18(26)23-13-11-22(17-9-7-16(15-25)8-10-17)12-14-24(23)19(27)29-21(4,5)6/h7-10,15H,11-14H2,1-6H3 |
| InChIKey | OPWGKQULRGWRDR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|