C18H24N2O3 — CID 177309388
tert-butyl 8-(4-formylphenyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 177309388) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl 8-(4-formylphenyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | tert-butyl 8-(4-formylphenyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 177309388 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl 8-(4-formylphenyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(C1)N2c1ccc(C=O)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-18(2,3)23-17(22)19-10-15-8-9-16(11-19)20(15)14-6-4-13(12-21)5-7-14/h4-7,12,15-16H,8-11H2,1-3H3 |
| InChIKey | QCOPYIIVXYVBPV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|