About tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide
tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide (PubChem CID 143759275) has the molecular formula C11H23N3O2S
and a molecular weight of 261.39 g/mol. Its IUPAC name is tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide.
Molecular Properties
| Compound Name | tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide |
| PubChem CID | 143759275 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide |
| SMILES | CN1CCN(C(=O)OC(C)(C)C)CC1.NC=S |
| InChI | InChI=1S/C10H20N2O2.CH3NS/c1-10(2,3)14-9(13)12-7-5-11(4)6-8-12;2-1-3/h5-8H2,1-4H3;1H,(H2,2,3) |
| InChIKey | OREZCSCDHDXIPQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide?
The IUPAC name of tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide (CID 143759275) is tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide.
What is the SMILES notation for tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide?
The canonical SMILES for tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide is CN1CCN(C(=O)OC(C)(C)C)CC1.NC=S.
What is the InChIKey of tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide?
The InChIKey is OREZCSCDHDXIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2.CH3NS/c1-10(2,3)14-9(13)12-7-5-11(4)6-8-12;2-1-3/h5-8H2,1-4H3;1H,(H2,2,3).
What are the key properties of tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide?
tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide has a molecular weight of 261.39 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-methylpiperazine-1-carboxylate;methanethioamide is sourced from PubChem (CID 143759275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).