C28H54N4O7 — CID 142939666
tert-butyl acetate;ditert-butyl 7-methyl-10-(2-oxopropyl)-1,4,7,10-tetrazacyclododecane-1,4-dicarboxylate (PubChem CID 142939666) has the molecular formula C28H54N4O7 and a molecular weight of 558.76 g/mol. Its IUPAC name is tert-butyl acetate;ditert-butyl 7-methyl-10-(2-oxopropyl)-1,4,7,10-tetrazacyclododecane-1,4-dicarboxylate.
| Compound Name | tert-butyl acetate;ditert-butyl 7-methyl-10-(2-oxopropyl)-1,4,7,10-tetrazacyclododecane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 142939666 |
| Molecular Formula | C28H54N4O7 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.40 |
| IUPAC Name | tert-butyl acetate;ditert-butyl 7-methyl-10-(2-oxopropyl)-1,4,7,10-tetrazacyclododecane-1,4-dicarboxylate |
| SMILES | CC(=O)CN1CCN(C)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1.CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H42N4O5.C6H12O2/c1-18(27)17-24-11-9-23(8)10-13-25(19(28)30-21(2,3)4)15-16-26(14-12-24)20(29)31-22(5,6)7;1-5(7)8-6(2,3)4/h9-17H2,1-8H3;1-4H3 |
| InChIKey | HVEMIWBIXJCEIT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 108.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|