About tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane
tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane (PubChem CID 123541126) has the molecular formula C16H35N3O2
and a molecular weight of 301.48 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane |
| PubChem CID | 123541126 |
| Molecular Formula | C16H35N3O2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.27 |
| IUPAC Name | tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane |
| SMILES | C/C(=C/N)N1CCN(C(=O)OC(C)(C)C)CC1.CC.CC |
| InChI | InChI=1S/C12H23N3O2.2C2H6/c1-10(9-13)14-5-7-15(8-6-14)11(16)17-12(2,3)4;2*1-2/h9H,5-8,13H2,1-4H3;2*1-2H3/b10-9-;; |
| InChIKey | LIBSVTIMYZXFGE-XXAVUKJNSA-N |
| XLogP | 3.41 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane?
The IUPAC name of tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane (CID 123541126) is tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane.
What is the SMILES notation for tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane?
The canonical SMILES for tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane is C/C(=C/N)N1CCN(C(=O)OC(C)(C)C)CC1.CC.CC.
What is the InChIKey of tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane?
The InChIKey is LIBSVTIMYZXFGE-XXAVUKJNSA-N. The full InChI is InChI=1S/C12H23N3O2.2C2H6/c1-10(9-13)14-5-7-15(8-6-14)11(16)17-12(2,3)4;2*1-2/h9H,5-8,13H2,1-4H3;2*1-2H3/b10-9-;;.
What are the key properties of tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane?
tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane has a molecular weight of 301.48 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(Z)-1-aminoprop-1-en-2-yl]piperazine-1-carboxylate;ethane is sourced from PubChem (CID 123541126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).