C16H17IN4O2S — CID 126643408
tert-butyl 2-[3-iodo-5-(2-methylpyrimidin-5-yl)thieno[3,2-c]pyrazol-1-yl]acetate (PubChem CID 126643408) has the molecular formula C16H17IN4O2S and a molecular weight of 456.31 g/mol. Its IUPAC name is tert-butyl 2-[3-iodo-5-(2-methylpyrimidin-5-yl)thieno[3,2-c]pyrazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-iodo-5-(2-methylpyrimidin-5-yl)thieno[3,2-c]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 126643408 |
| Molecular Formula | C16H17IN4O2S |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | tert-butyl 2-[3-iodo-5-(2-methylpyrimidin-5-yl)thieno[3,2-c]pyrazol-1-yl]acetate |
| SMILES | Cc1ncc(-c2cc3c(s2)c(I)nn3CC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C16H17IN4O2S/c1-9-18-6-10(7-19-9)12-5-11-14(24-12)15(17)20-21(11)8-13(22)23-16(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | QVHHBEXPMZTMQI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|