C19H21N5O4 — CID 142420428
tert-butyl 2-[3-acetyl-5-(2-methyl-1-oxidopyrimidin-1-ium-5-yl)pyrazolo[3,4-c]pyridin-1-yl]acetate (PubChem CID 142420428) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is tert-butyl 2-[3-acetyl-5-(2-methyl-1-oxidopyrimidin-1-ium-5-yl)pyrazolo[3,4-c]pyridin-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-acetyl-5-(2-methyl-1-oxidopyrimidin-1-ium-5-yl)pyrazolo[3,4-c]pyridin-1-yl]acetate |
|---|---|
| PubChem CID | 142420428 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl 2-[3-acetyl-5-(2-methyl-1-oxidopyrimidin-1-ium-5-yl)pyrazolo[3,4-c]pyridin-1-yl]acetate |
| SMILES | CC(=O)c1nn(CC(=O)OC(C)(C)C)c2cnc(-c3cnc(C)[n+]([O-])c3)cc12 |
| InChI | InChI=1S/C19H21N5O4/c1-11(25)18-14-6-15(13-7-20-12(2)24(27)9-13)21-8-16(14)23(22-18)10-17(26)28-19(3,4)5/h6-9H,10H2,1-5H3 |
| InChIKey | FPVACHBLPISJNT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 113.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|