C22H25FN4O3 — CID 142420387
tert-butyl 2-[3-acetyl-7-(1-fluoroethyl)-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetate (PubChem CID 142420387) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is tert-butyl 2-[3-acetyl-7-(1-fluoroethyl)-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-acetyl-7-(1-fluoroethyl)-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetate |
|---|---|
| PubChem CID | 142420387 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | tert-butyl 2-[3-acetyl-7-(1-fluoroethyl)-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetate |
| SMILES | CC(=O)c1nn(CC(=O)OC(C)(C)C)c2c(C(C)F)cc(-c3cnc(C)nc3)cc12 |
| InChI | InChI=1S/C22H25FN4O3/c1-12(23)17-7-15(16-9-24-14(3)25-10-16)8-18-20(13(2)28)26-27(21(17)18)11-19(29)30-22(4,5)6/h7-10,12H,11H2,1-6H3 |
| InChIKey | ACKRIDCNDUIGKG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |