C15H20N2O3 — CID 123586260
tert-butyl 2-(3-ethyl-5-hydroxyindazol-1-yl)acetate (PubChem CID 123586260) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is tert-butyl 2-(3-ethyl-5-hydroxyindazol-1-yl)acetate.
| Compound Name | tert-butyl 2-(3-ethyl-5-hydroxyindazol-1-yl)acetate |
|---|---|
| PubChem CID | 123586260 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | tert-butyl 2-(3-ethyl-5-hydroxyindazol-1-yl)acetate |
| SMILES | CCc1nn(CC(=O)OC(C)(C)C)c2ccc(O)cc12 |
| InChI | InChI=1S/C15H20N2O3/c1-5-12-11-8-10(18)6-7-13(11)17(16-12)9-14(19)20-15(2,3)4/h6-8,18H,5,9H2,1-4H3 |
| InChIKey | GSUDLAYCNSJHMN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |